C13H9ClN2O3 — CID 115109327
5-(6-chloro-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 115109327) has the molecular formula C13H9ClN2O3 and a molecular weight of 276.68 g/mol. Its IUPAC name is 5-(6-chloro-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(6-chloro-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115109327 |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-(6-chloro-1-methylindol-2-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Cn1c(-c2oncc2C(=O)O)cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H9ClN2O3/c1-16-10-5-8(14)3-2-7(10)4-11(16)12-9(13(17)18)6-15-19-12/h2-6H,1H3,(H,17,18) |
| InChIKey | HALJZVRFRNSGFD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |