C13H13N3O2 — CID 115109081
5-(5-methoxy-1-methylindol-3-yl)-1,2-oxazol-4-amine (PubChem CID 115109081) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 5-(5-methoxy-1-methylindol-3-yl)-1,2-oxazol-4-amine.
| Compound Name | 5-(5-methoxy-1-methylindol-3-yl)-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 115109081 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-(5-methoxy-1-methylindol-3-yl)-1,2-oxazol-4-amine |
| SMILES | COc1ccc2c(c1)c(-c1oncc1N)cn2C |
| InChI | InChI=1S/C13H13N3O2/c1-16-7-10(13-11(14)6-15-18-13)9-5-8(17-2)3-4-12(9)16/h3-7H,14H2,1-2H3 |
| InChIKey | QESZMVBDYNEBPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |