C17H14N2OS2 — CID 155815622
2-(5-methoxy-1-methylindol-3-yl)-4-thiophen-3-yl-1,3-thiazole (PubChem CID 155815622) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-(5-methoxy-1-methylindol-3-yl)-4-thiophen-3-yl-1,3-thiazole.
| Compound Name | 2-(5-methoxy-1-methylindol-3-yl)-4-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 155815622 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(5-methoxy-1-methylindol-3-yl)-4-thiophen-3-yl-1,3-thiazole |
| SMILES | COc1ccc2c(c1)c(-c1nc(-c3ccsc3)cs1)cn2C |
| InChI | InChI=1S/C17H14N2OS2/c1-19-8-14(13-7-12(20-2)3-4-16(13)19)17-18-15(10-22-17)11-5-6-21-9-11/h3-10H,1-2H3 |
| InChIKey | HLOXGXHKWKODCJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |