C23H18N2OS — CID 155807224
2-(5-methoxy-1-methylindol-3-yl)-4-naphthalen-2-yl-1,3-thiazole (PubChem CID 155807224) has the molecular formula C23H18N2OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(5-methoxy-1-methylindol-3-yl)-4-naphthalen-2-yl-1,3-thiazole.
| Compound Name | 2-(5-methoxy-1-methylindol-3-yl)-4-naphthalen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 155807224 |
| Molecular Formula | C23H18N2OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(5-methoxy-1-methylindol-3-yl)-4-naphthalen-2-yl-1,3-thiazole |
| SMILES | COc1ccc2c(c1)c(-c1nc(-c3ccc4ccccc4c3)cs1)cn2C |
| InChI | InChI=1S/C23H18N2OS/c1-25-13-20(19-12-18(26-2)9-10-22(19)25)23-24-21(14-27-23)17-8-7-15-5-3-4-6-16(15)11-17/h3-14H,1-2H3 |
| InChIKey | DNTFMVJJWPDKND-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |