C13H9FN2O3 — CID 117404267
5-(5-fluoro-1-methylindol-6-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117404267) has the molecular formula C13H9FN2O3 and a molecular weight of 260.22 g/mol. Its IUPAC name is 5-(5-fluoro-1-methylindol-6-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(5-fluoro-1-methylindol-6-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117404267 |
| Molecular Formula | C13H9FN2O3 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-(5-fluoro-1-methylindol-6-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cn1ccc2cc(F)c(-c3cc(C(=O)O)no3)cc21 |
| InChI | InChI=1S/C13H9FN2O3/c1-16-3-2-7-4-9(14)8(5-11(7)16)12-6-10(13(17)18)15-19-12/h2-6H,1H3,(H,17,18) |
| InChIKey | ZERNJCNLZOEJSO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |