C12H7FN2O3 — CID 117367183
5-(5-fluoro-1H-indol-6-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117367183) has the molecular formula C12H7FN2O3 and a molecular weight of 246.20 g/mol. Its IUPAC name is 5-(5-fluoro-1H-indol-6-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(5-fluoro-1H-indol-6-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117367183 |
| Molecular Formula | C12H7FN2O3 |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-(5-fluoro-1H-indol-6-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3[nH]ccc3cc2F)on1 |
| InChI | InChI=1S/C12H7FN2O3/c13-8-3-6-1-2-14-9(6)4-7(8)11-5-10(12(16)17)15-18-11/h1-5,14H,(H,16,17) |
| InChIKey | VJCBWGPHXVHZAH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |