About [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate
[5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate (PubChem CID 118121817) has the molecular formula C30H30O8
and a molecular weight of 518.56 g/mol. Its IUPAC name is [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate.
Molecular Properties
| Compound Name | [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate |
| PubChem CID | 118121817 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate |
| SMILES | CCCCOC(=O)Oc1ccc2c(-c3c(O)ccc4cc(OC(=O)OCCCC)ccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C30H30O8/c1-3-5-15-35-29(33)37-21-9-11-23-19(17-21)7-13-25(31)27(23)28-24-12-10-22(18-20(24)8-14-26(28)32)38-30(34)36-16-6-4-2/h7-14,17-18,31-32H,3-6,15-16H2,1-2H3 |
| InChIKey | OILURWGPORIFFD-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate?
The IUPAC name of [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate (CID 118121817) is [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate.
What is the SMILES notation for [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate?
The canonical SMILES for [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate is CCCCOC(=O)Oc1ccc2c(-c3c(O)ccc4cc(OC(=O)OCCCC)ccc34)c(O)ccc2c1.
What is the InChIKey of [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate?
The InChIKey is OILURWGPORIFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30O8/c1-3-5-15-35-29(33)37-21-9-11-23-19(17-21)7-13-25(31)27(23)28-24-12-10-22(18-20(24)8-14-26(28)32)38-30(34)36-16-6-4-2/h7-14,17-18,31-32H,3-6,15-16H2,1-2H3.
What are the key properties of [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate?
[5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate has a molecular weight of 518.56 g/mol, XLogP of 7.70, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(6-butoxycarbonyloxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalen-2-yl] butyl carbonate is sourced from PubChem (CID 118121817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).