C32H42O4Si2 — CID 135016989
1-(2-hydroxy-6-triethylsilyloxynaphthalen-1-yl)-6-triethylsilyloxynaphthalen-2-ol (PubChem CID 135016989) has the molecular formula C32H42O4Si2 and a molecular weight of 546.86 g/mol. Its IUPAC name is 1-(2-hydroxy-6-triethylsilyloxynaphthalen-1-yl)-6-triethylsilyloxynaphthalen-2-ol.
| Compound Name | 1-(2-hydroxy-6-triethylsilyloxynaphthalen-1-yl)-6-triethylsilyloxynaphthalen-2-ol |
|---|---|
| PubChem CID | 135016989 |
| Molecular Formula | C32H42O4Si2 |
| Molecular Weight | 546.86 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 1-(2-hydroxy-6-triethylsilyloxynaphthalen-1-yl)-6-triethylsilyloxynaphthalen-2-ol |
| SMILES | CC[Si](CC)(CC)Oc1ccc2c(-c3c(O)ccc4cc(O[Si](CC)(CC)CC)ccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C32H42O4Si2/c1-7-37(8-2,9-3)35-25-15-17-27-23(21-25)13-19-29(33)31(27)32-28-18-16-26(22-24(28)14-20-30(32)34)36-38(10-4,11-5)12-6/h13-22,33-34H,7-12H2,1-6H3 |
| InChIKey | JGFUATNPBUDTQW-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.86 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|