C24H36IO2SSi2- — CID 59503331
CID 59503331 (PubChem CID 59503331) has the molecular formula C24H36IO2SSi2- and a molecular weight of 571.69 g/mol.
| Compound Name | CID 59503331 |
|---|---|
| PubChem CID | 59503331 |
| Molecular Formula | C24H36IO2SSi2- |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)(CC)Oc1ccc2c(c1)Sc1cc(O[Si](CC)(CC)CC)ccc1[I-]2 |
| InChI | InChI=1S/C24H36IO2SSi2/c1-7-29(8-2,9-3)26-19-13-15-21-23(17-19)28-24-18-20(14-16-22(24)25-21)27-30(10-4,11-5)12-6/h13-18H,7-12H2,1-6H3/q-1 |
| InChIKey | FULGHFZTNQBEID-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|