C58H92O6Si4 — CID 165050985
3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenol;3-tri(propan-2-yl)silyloxy-5-[(E)-2-[4-tri(propan-2-yl)silyloxyphenyl]ethenyl]phenol (PubChem CID 165050985) has the molecular formula C58H92O6Si4 and a molecular weight of 997.71 g/mol. Its IUPAC name is 3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenol;3-tri(propan-2-yl)silyloxy-5-[(E)-2-[4-tri(propan-2-yl)silyloxyphenyl]ethenyl]phenol.
| Compound Name | 3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenol;3-tri(propan-2-yl)silyloxy-5-[(E)-2-[4-tri(propan-2-yl)silyloxyphenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 165050985 |
| Molecular Formula | C58H92O6Si4 |
| Molecular Weight | 997.71 g/mol |
| Exact Mass | 996.60 |
| IUPAC Name | 3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenol;3-tri(propan-2-yl)silyloxy-5-[(E)-2-[4-tri(propan-2-yl)silyloxyphenyl]ethenyl]phenol |
| SMILES | CC(C)[Si](Oc1ccc(/C=C/c2cc(O)cc(O[Si](C(C)C)(C(C)C)C(C)C)c2)cc1)(C(C)C)C(C)C.CC[Si](CC)(CC)Oc1ccc(/C=C/c2cc(O)cc(O[Si](CC)(CC)CC)c2)cc1 |
| InChI | InChI=1S/C32H52O3Si2.C26H40O3Si2/c1-22(2)36(23(3)4,24(5)6)34-31-17-15-28(16-18-31)13-14-29-19-30(33)21-32(20-29)35-37(25(7)8,26(9)10)27(11)12;1-7-30(8-2,9-3)28-25-17-15-22(16-18-25)13-14-23-19-24(27)21-26(20-23)29-31(10-4,11-5)12-6/h13-27,33H,1-12H3;13-21,27H,7-12H2,1-6H3/b2*14-13+ |
| InChIKey | PQRQUTMLGSJCDH-IGRBIYNPSA-N |
| XLogP | 19.00 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.71 |
| LogP ≤ 5 | 19.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|