C34H54O4Si2 — CID 140771666
[4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenyl] acetate (PubChem CID 140771666) has the molecular formula C34H54O4Si2 and a molecular weight of 582.97 g/mol. Its IUPAC name is [4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 140771666 |
| Molecular Formula | C34H54O4Si2 |
| Molecular Weight | 582.97 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | [4-[(E)-2-[3,5-bis[tri(propan-2-yl)silyloxy]phenyl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/c2cc(O[Si](C(C)C)(C(C)C)C(C)C)cc(O[Si](C(C)C)(C(C)C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C34H54O4Si2/c1-23(2)39(24(3)4,25(5)6)37-33-20-31(15-14-30-16-18-32(19-17-30)36-29(13)35)21-34(22-33)38-40(26(7)8,27(9)10)28(11)12/h14-28H,1-13H3/b15-14+ |
| InChIKey | JUOFGPWQOBRPKB-CCEZHUSRSA-N |
| XLogP | 10.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.97 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|