C32H54O3Si3 — CID 153432750
triethyl-[3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenoxy]silane (PubChem CID 153432750) has the molecular formula C32H54O3Si3 and a molecular weight of 571.04 g/mol. Its IUPAC name is triethyl-[3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenoxy]silane.
| Compound Name | triethyl-[3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenoxy]silane |
|---|---|
| PubChem CID | 153432750 |
| Molecular Formula | C32H54O3Si3 |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | triethyl-[3-triethylsilyloxy-5-[(E)-2-(4-triethylsilyloxyphenyl)ethenyl]phenoxy]silane |
| SMILES | CC[Si](CC)(CC)Oc1ccc(/C=C/c2cc(O[Si](CC)(CC)CC)cc(O[Si](CC)(CC)CC)c2)cc1 |
| InChI | InChI=1S/C32H54O3Si3/c1-10-36(11-2,12-3)33-30-23-21-28(22-24-30)19-20-29-25-31(34-37(13-4,14-5)15-6)27-32(26-29)35-38(16-7,17-8)18-9/h19-27H,10-18H2,1-9H3/b20-19+ |
| InChIKey | DWRWSUYYOAHRSP-FMQUCBEESA-N |
| XLogP | 11.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|