C44H50O2 — CID 102103016
5,6,7,8-tetraethyl-1-(5,6,7,8-tetraethyl-2-hydroxyanthracen-1-yl)anthracen-2-ol (PubChem CID 102103016) has the molecular formula C44H50O2 and a molecular weight of 610.88 g/mol. Its IUPAC name is 5,6,7,8-tetraethyl-1-(5,6,7,8-tetraethyl-2-hydroxyanthracen-1-yl)anthracen-2-ol.
| Compound Name | 5,6,7,8-tetraethyl-1-(5,6,7,8-tetraethyl-2-hydroxyanthracen-1-yl)anthracen-2-ol |
|---|---|
| PubChem CID | 102103016 |
| Molecular Formula | C44H50O2 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 5,6,7,8-tetraethyl-1-(5,6,7,8-tetraethyl-2-hydroxyanthracen-1-yl)anthracen-2-ol |
| SMILES | CCc1c(CC)c(CC)c2cc3c(-c4c(O)ccc5cc6c(CC)c(CC)c(CC)c(CC)c6cc45)c(O)ccc3cc2c1CC |
| InChI | InChI=1S/C44H50O2/c1-9-27-29(11-3)33(15-7)39-23-35-25(21-37(39)31(27)13-5)17-19-41(45)43(35)44-36-24-40-34(16-8)30(12-4)28(10-2)32(14-6)38(40)22-26(36)18-20-42(44)46/h17-24,45-46H,9-16H2,1-8H3 |
| InChIKey | KHHIFRNUKWBUKG-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|