C24H17FN2O6 — CID 57423251
2-[[6-[4-(4-fluorophenoxy)phenoxy]-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 57423251) has the molecular formula C24H17FN2O6 and a molecular weight of 448.41 g/mol. Its IUPAC name is 2-[[6-[4-(4-fluorophenoxy)phenoxy]-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[6-[4-(4-fluorophenoxy)phenoxy]-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 57423251 |
| Molecular Formula | C24H17FN2O6 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[[6-[4-(4-fluorophenoxy)phenoxy]-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ncc2ccc(Oc3ccc(Oc4ccc(F)cc4)cc3)cc2c1O |
| InChI | InChI=1S/C24H17FN2O6/c25-15-2-5-16(6-3-15)32-17-7-9-18(10-8-17)33-19-4-1-14-12-26-22(23(30)20(14)11-19)24(31)27-13-21(28)29/h1-12,30H,13H2,(H,27,31)(H,28,29) |
| InChIKey | QRZXFEZQKOCZMX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |