C19H15ClN2O6 — CID 11429571
2-[[1-chloro-4-hydroxy-6-(4-methoxyphenoxy)isoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 11429571) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is 2-[[1-chloro-4-hydroxy-6-(4-methoxyphenoxy)isoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-chloro-4-hydroxy-6-(4-methoxyphenoxy)isoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 11429571 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[[1-chloro-4-hydroxy-6-(4-methoxyphenoxy)isoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | COc1ccc(Oc2ccc3c(Cl)nc(C(=O)NCC(=O)O)c(O)c3c2)cc1 |
| InChI | InChI=1S/C19H15ClN2O6/c1-27-10-2-4-11(5-3-10)28-12-6-7-13-14(8-12)17(25)16(22-18(13)20)19(26)21-9-15(23)24/h2-8,25H,9H2,1H3,(H,21,26)(H,23,24) |
| InChIKey | QBLGJCXZDGUPFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|