C13H11ClN2O6 — CID 56999690
[(2-hydroxyacetyl)amino] 1-chloro-4-hydroxy-6-methoxyisoquinoline-3-carboxylate (PubChem CID 56999690) has the molecular formula C13H11ClN2O6 and a molecular weight of 326.69 g/mol. Its IUPAC name is [(2-hydroxyacetyl)amino] 1-chloro-4-hydroxy-6-methoxyisoquinoline-3-carboxylate.
| Compound Name | [(2-hydroxyacetyl)amino] 1-chloro-4-hydroxy-6-methoxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 56999690 |
| Molecular Formula | C13H11ClN2O6 |
| Molecular Weight | 326.69 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [(2-hydroxyacetyl)amino] 1-chloro-4-hydroxy-6-methoxyisoquinoline-3-carboxylate |
| SMILES | COc1ccc2c(Cl)nc(C(=O)ONC(=O)CO)c(O)c2c1 |
| InChI | InChI=1S/C13H11ClN2O6/c1-21-6-2-3-7-8(4-6)11(19)10(15-12(7)14)13(20)22-16-9(18)5-17/h2-4,17,19H,5H2,1H3,(H,16,18) |
| InChIKey | FZNPPEPBXAFZOL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.69 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|