C12H9N3O3 — CID 141385106
1-cyano-4-hydroxy-6-methoxyisoquinoline-3-carboxamide (PubChem CID 141385106) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-cyano-4-hydroxy-6-methoxyisoquinoline-3-carboxamide.
| Compound Name | 1-cyano-4-hydroxy-6-methoxyisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 141385106 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-cyano-4-hydroxy-6-methoxyisoquinoline-3-carboxamide |
| SMILES | COc1ccc2c(C#N)nc(C(N)=O)c(O)c2c1 |
| InChI | InChI=1S/C12H9N3O3/c1-18-6-2-3-7-8(4-6)11(16)10(12(14)17)15-9(7)5-13/h2-4,16H,1H3,(H2,14,17) |
| InChIKey | AHAHNEZDFSNABB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |