C22H20N4O3 — CID 68520882
3-cyano-N-[2-(dimethylamino)-2-oxoethyl]-6-methoxy-4-phenylisoquinoline-1-carboxamide (PubChem CID 68520882) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-cyano-N-[2-(dimethylamino)-2-oxoethyl]-6-methoxy-4-phenylisoquinoline-1-carboxamide.
| Compound Name | 3-cyano-N-[2-(dimethylamino)-2-oxoethyl]-6-methoxy-4-phenylisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 68520882 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-cyano-N-[2-(dimethylamino)-2-oxoethyl]-6-methoxy-4-phenylisoquinoline-1-carboxamide |
| SMILES | COc1ccc2c(C(=O)NCC(=O)N(C)C)nc(C#N)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C22H20N4O3/c1-26(2)19(27)13-24-22(28)21-16-10-9-15(29-3)11-17(16)20(18(12-23)25-21)14-7-5-4-6-8-14/h4-11H,13H2,1-3H3,(H,24,28) |
| InChIKey | ZEFCMNFXFJQGEY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |