C19H15N3O4 — CID 122680875
1-cyano-4-hydroxy-7-(4-methoxyphenoxy)-N-methylisoquinoline-3-carboxamide (PubChem CID 122680875) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-cyano-4-hydroxy-7-(4-methoxyphenoxy)-N-methylisoquinoline-3-carboxamide.
| Compound Name | 1-cyano-4-hydroxy-7-(4-methoxyphenoxy)-N-methylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 122680875 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-cyano-4-hydroxy-7-(4-methoxyphenoxy)-N-methylisoquinoline-3-carboxamide |
| SMILES | CNC(=O)c1nc(C#N)c2cc(Oc3ccc(OC)cc3)ccc2c1O |
| InChI | InChI=1S/C19H15N3O4/c1-21-19(24)17-18(23)14-8-7-13(9-15(14)16(10-20)22-17)26-12-5-3-11(25-2)4-6-12/h3-9,23H,1-2H3,(H,21,24) |
| InChIKey | TVSWTJXHAYOWSG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |