C22H19N3O5 — CID 71737377
(3R)-3-[(1-cyano-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]pentanoic acid (PubChem CID 71737377) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (3R)-3-[(1-cyano-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]pentanoic acid.
| Compound Name | (3R)-3-[(1-cyano-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 71737377 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (3R)-3-[(1-cyano-4-hydroxy-7-phenoxyisoquinoline-3-carbonyl)amino]pentanoic acid |
| SMILES | CC[C@H](CC(=O)O)NC(=O)c1nc(C#N)c2cc(Oc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C22H19N3O5/c1-2-13(10-19(26)27)24-22(29)20-21(28)16-9-8-15(11-17(16)18(12-23)25-20)30-14-6-4-3-5-7-14/h3-9,11,13,28H,2,10H2,1H3,(H,24,29)(H,26,27)/t13-/m1/s1 |
| InChIKey | XBMFFUGFOFOFEO-CYBMUJFWSA-N |
| XLogP | 3.59 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |