C18H21ClN2O5 — CID 87120171
(2R)-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 87120171) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is (2R)-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87120171 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2R)-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)Oc1ccc2c(Cl)nc(C(=O)N[C@@H](C(=O)O)C(C)C)c(O)c2c1 |
| InChI | InChI=1S/C18H21ClN2O5/c1-8(2)13(18(24)25)21-17(23)14-15(22)12-7-10(26-9(3)4)5-6-11(12)16(19)20-14/h5-9,13,22H,1-4H3,(H,21,23)(H,24,25)/t13-/m1/s1 |
| InChIKey | SWMGXKRIPILTFR-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|