C16H19ClN2O6 — CID 87190062
(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinolin-3-yl) N-(1,3-dihydroxypropan-2-yl)carbamate (PubChem CID 87190062) has the molecular formula C16H19ClN2O6 and a molecular weight of 370.79 g/mol. Its IUPAC name is (1-chloro-4-hydroxy-6-propan-2-yloxyisoquinolin-3-yl) N-(1,3-dihydroxypropan-2-yl)carbamate.
| Compound Name | (1-chloro-4-hydroxy-6-propan-2-yloxyisoquinolin-3-yl) N-(1,3-dihydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 87190062 |
| Molecular Formula | C16H19ClN2O6 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (1-chloro-4-hydroxy-6-propan-2-yloxyisoquinolin-3-yl) N-(1,3-dihydroxypropan-2-yl)carbamate |
| SMILES | CC(C)Oc1ccc2c(Cl)nc(OC(=O)NC(CO)CO)c(O)c2c1 |
| InChI | InChI=1S/C16H19ClN2O6/c1-8(2)24-10-3-4-11-12(5-10)13(22)15(19-14(11)17)25-16(23)18-9(6-20)7-21/h3-5,8-9,20-22H,6-7H2,1-2H3,(H,18,23) |
| InChIKey | UVRDMGZWUHULID-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|