C21H25ClF3N3O7 — CID 87194417
(2S)-6-amino-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 87194417) has the molecular formula C21H25ClF3N3O7 and a molecular weight of 523.89 g/mol. Its IUPAC name is (2S)-6-amino-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-6-amino-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87194417 |
| Molecular Formula | C21H25ClF3N3O7 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (2S)-6-amino-2-[(1-chloro-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)Oc1ccc2c(Cl)nc(C(=O)N[C@@H](CCCCN)C(=O)O)c(O)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24ClN3O5.C2HF3O2/c1-10(2)28-11-6-7-12-13(9-11)16(24)15(23-17(12)20)18(25)22-14(19(26)27)5-3-4-8-21;3-2(4,5)1(6)7/h6-7,9-10,14,24H,3-5,8,21H2,1-2H3,(H,22,25)(H,26,27);(H,6,7)/t14-;/m0./s1 |
| InChIKey | ULYCZEYHMPZZKP-UQKRIMTDSA-N |
| XLogP | 3.33 |
| TPSA | 172.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|