C21H23ClF3N3O6 — CID 87678944
(2,2,2-trifluoroacetyl) (2R)-6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoate (PubChem CID 87678944) has the molecular formula C21H23ClF3N3O6 and a molecular weight of 505.88 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R)-6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R)-6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 87678944 |
| Molecular Formula | C21H23ClF3N3O6 |
| Molecular Weight | 505.88 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R)-6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoate |
| SMILES | CC(C)Oc1ccc2c(O)c(C(=O)N[C@H](CCCCN)C(=O)OC(=O)C(F)(F)F)nc(Cl)c2c1 |
| InChI | InChI=1S/C21H23ClF3N3O6/c1-10(2)33-11-6-7-12-13(9-11)17(22)28-15(16(12)29)18(30)27-14(5-3-4-8-26)19(31)34-20(32)21(23,24)25/h6-7,9-10,14,29H,3-5,8,26H2,1-2H3,(H,27,30)/t14-/m1/s1 |
| InChIKey | HOIYUAOGBANDPG-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|