C19H24ClN3O5 — CID 87120116
6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid (PubChem CID 87120116) has the molecular formula C19H24ClN3O5 and a molecular weight of 409.87 g/mol. Its IUPAC name is 6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 87120116 |
| Molecular Formula | C19H24ClN3O5 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 6-amino-2-[(1-chloro-4-hydroxy-7-propan-2-yloxyisoquinoline-3-carbonyl)amino]hexanoic acid |
| SMILES | CC(C)Oc1ccc2c(O)c(C(=O)NC(CCCCN)C(=O)O)nc(Cl)c2c1 |
| InChI | InChI=1S/C19H24ClN3O5/c1-10(2)28-11-6-7-12-13(9-11)17(20)23-15(16(12)24)18(25)22-14(19(26)27)5-3-4-8-21/h6-7,9-10,14,24H,3-5,8,21H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | FAEUXUGPGAVTCW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|