C16H17ClN2O6 — CID 90870185
1-(2-amino-1-chloro-1-methoxy-2-oxoethyl)-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carboxylic acid (PubChem CID 90870185) has the molecular formula C16H17ClN2O6 and a molecular weight of 368.77 g/mol. Its IUPAC name is 1-(2-amino-1-chloro-1-methoxy-2-oxoethyl)-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carboxylic acid.
| Compound Name | 1-(2-amino-1-chloro-1-methoxy-2-oxoethyl)-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 90870185 |
| Molecular Formula | C16H17ClN2O6 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(2-amino-1-chloro-1-methoxy-2-oxoethyl)-4-hydroxy-6-propan-2-yloxyisoquinoline-3-carboxylic acid |
| SMILES | COC(Cl)(C(N)=O)c1nc(C(=O)O)c(O)c2cc(OC(C)C)ccc12 |
| InChI | InChI=1S/C16H17ClN2O6/c1-7(2)25-8-4-5-9-10(6-8)12(20)11(14(21)22)19-13(9)16(17,24-3)15(18)23/h4-7,20H,1-3H3,(H2,18,23)(H,21,22) |
| InChIKey | SVKWEWALFPQAEE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|