C19H15ClN2O5 — CID 11165097
2-[[7-(4-chlorophenoxy)-4-hydroxy-1-methylisoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 11165097) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is 2-[[7-(4-chlorophenoxy)-4-hydroxy-1-methylisoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[7-(4-chlorophenoxy)-4-hydroxy-1-methylisoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 11165097 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[[7-(4-chlorophenoxy)-4-hydroxy-1-methylisoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | Cc1nc(C(=O)NCC(=O)O)c(O)c2ccc(Oc3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C19H15ClN2O5/c1-10-15-8-13(27-12-4-2-11(20)3-5-12)6-7-14(15)18(25)17(22-10)19(26)21-9-16(23)24/h2-8,25H,9H2,1H3,(H,21,26)(H,23,24) |
| InChIKey | GNITUPICGGJLFJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |