C22H19N5O4 — CID 142696956
butyl 1-cyano-4-hydroxy-6-(2-methylbenzotriazol-5-yl)oxyisoquinoline-3-carboxylate (PubChem CID 142696956) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is butyl 1-cyano-4-hydroxy-6-(2-methylbenzotriazol-5-yl)oxyisoquinoline-3-carboxylate.
| Compound Name | butyl 1-cyano-4-hydroxy-6-(2-methylbenzotriazol-5-yl)oxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142696956 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | butyl 1-cyano-4-hydroxy-6-(2-methylbenzotriazol-5-yl)oxyisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(C#N)c2ccc(Oc3ccc4nn(C)nc4c3)cc2c1O |
| InChI | InChI=1S/C22H19N5O4/c1-3-4-9-30-22(29)20-21(28)16-10-13(5-7-15(16)19(12-23)24-20)31-14-6-8-17-18(11-14)26-27(2)25-17/h5-8,10-11,28H,3-4,9H2,1-2H3 |
| InChIKey | NWMVVVXZAGVDGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|