C26H24N4O5S — CID 67110404
butyl 1-cyano-4-hydroxy-6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)oxy]isoquinoline-3-carboxylate (PubChem CID 67110404) has the molecular formula C26H24N4O5S and a molecular weight of 504.57 g/mol. Its IUPAC name is butyl 1-cyano-4-hydroxy-6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)oxy]isoquinoline-3-carboxylate.
| Compound Name | butyl 1-cyano-4-hydroxy-6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)oxy]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67110404 |
| Molecular Formula | C26H24N4O5S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | butyl 1-cyano-4-hydroxy-6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)oxy]isoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1nc(C#N)c2ccc(Oc3ccc4nc(N5CCOCC5)sc4c3)cc2c1O |
| InChI | InChI=1S/C26H24N4O5S/c1-2-3-10-34-25(32)23-24(31)19-13-16(4-6-18(19)21(15-27)28-23)35-17-5-7-20-22(14-17)36-26(29-20)30-8-11-33-12-9-30/h4-7,13-14,31H,2-3,8-12H2,1H3 |
| InChIKey | QXOQXTDTZORARJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|