C21H23NO4 — CID 155782315
ethane;ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate (PubChem CID 155782315) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethane;ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate.
| Compound Name | ethane;ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 155782315 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | ethane;ethyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate |
| SMILES | CC.CCOC(=O)c1nc(C)c2cc(Oc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C19H17NO4.C2H6/c1-3-23-19(22)17-18(21)15-10-9-14(11-16(15)12(2)20-17)24-13-7-5-4-6-8-13;1-2/h4-11,21H,3H2,1-2H3;1-2H3 |
| InChIKey | JETQZEDHBRBJFD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |