C47H35BrN2O8 — CID 161270780
benzyl 1-methyl-6-phenoxy-4-phenylmethoxyisoquinoline-3-carboxylate;1-bromo-4-hydroxy-6-phenoxyisoquinoline-3-carboxylic acid (PubChem CID 161270780) has the molecular formula C47H35BrN2O8 and a molecular weight of 835.71 g/mol. Its IUPAC name is benzyl 1-methyl-6-phenoxy-4-phenylmethoxyisoquinoline-3-carboxylate;1-bromo-4-hydroxy-6-phenoxyisoquinoline-3-carboxylic acid.
| Compound Name | benzyl 1-methyl-6-phenoxy-4-phenylmethoxyisoquinoline-3-carboxylate;1-bromo-4-hydroxy-6-phenoxyisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 161270780 |
| Molecular Formula | C47H35BrN2O8 |
| Molecular Weight | 835.71 g/mol |
| Exact Mass | 834.16 |
| IUPAC Name | benzyl 1-methyl-6-phenoxy-4-phenylmethoxyisoquinoline-3-carboxylate;1-bromo-4-hydroxy-6-phenoxyisoquinoline-3-carboxylic acid |
| SMILES | Cc1nc(C(=O)OCc2ccccc2)c(OCc2ccccc2)c2cc(Oc3ccccc3)ccc12.O=C(O)c1nc(Br)c2ccc(Oc3ccccc3)cc2c1O |
| InChI | InChI=1S/C31H25NO4.C16H10BrNO4/c1-22-27-18-17-26(36-25-15-9-4-10-16-25)19-28(27)30(34-20-23-11-5-2-6-12-23)29(32-22)31(33)35-21-24-13-7-3-8-14-24;17-15-11-7-6-10(22-9-4-2-1-3-5-9)8-12(11)14(19)13(18-15)16(20)21/h2-19H,20-21H2,1H3;1-8,19H,(H,20,21) |
| InChIKey | VDUAMJSVIXXLLA-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.71 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|