C19H18N2O5 — CID 147505742
2-[[hydroxy-(4-hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)methyl]amino]acetic acid (PubChem CID 147505742) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[[hydroxy-(4-hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)methyl]amino]acetic acid.
| Compound Name | 2-[[hydroxy-(4-hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 147505742 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[[hydroxy-(4-hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)methyl]amino]acetic acid |
| SMILES | Cc1nc(C(O)NCC(=O)O)c(O)c2ccc(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C19H18N2O5/c1-11-15-9-13(26-12-5-3-2-4-6-12)7-8-14(15)18(24)17(21-11)19(25)20-10-16(22)23/h2-9,19-20,24-25H,10H2,1H3,(H,22,23) |
| InChIKey | FIHJNISRATUZFW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|