C20H18N2O6 — CID 68916509
2-[[4-[hydroxy(methoxy)methyl]-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 68916509) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-[[4-[hydroxy(methoxy)methyl]-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-[hydroxy(methoxy)methyl]-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 68916509 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[[4-[hydroxy(methoxy)methyl]-7-phenoxyisoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | COC(O)c1c(C(=O)NCC(=O)O)ncc2cc(Oc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H18N2O6/c1-27-20(26)17-15-8-7-14(28-13-5-3-2-4-6-13)9-12(15)10-21-18(17)19(25)22-11-16(23)24/h2-10,20,26H,11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | UWIICSFRPDSEBQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|