C17H20N2O4S — CID 86676947
ethyl 2-[2-(4-methoxyphenyl)butanoylamino]-1,3-thiazole-5-carboxylate (PubChem CID 86676947) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is ethyl 2-[2-(4-methoxyphenyl)butanoylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(4-methoxyphenyl)butanoylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 86676947 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | ethyl 2-[2-(4-methoxyphenyl)butanoylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)C(CC)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C17H20N2O4S/c1-4-13(11-6-8-12(22-3)9-7-11)15(20)19-17-18-10-14(24-17)16(21)23-5-2/h6-10,13H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | UFGATRPYFKMYKH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |