C16H9ClN2O2 — CID 78294875
2-(4-chlorophenyl)-4aH-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 78294875) has the molecular formula C16H9ClN2O2 and a molecular weight of 296.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4aH-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-4aH-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78294875 |
| Molecular Formula | C16H9ClN2O2 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(4-chlorophenyl)-4aH-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | O=C1N=C(c2ccc(Cl)cc2)N=C2c3ccccc3OC12 |
| InChI | InChI=1S/C16H9ClN2O2/c17-10-7-5-9(6-8-10)15-18-13-11-3-1-2-4-12(11)21-14(13)16(20)19-15/h1-8,14H |
| InChIKey | GEHMUVWGKVCYCD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |