C30H19Cl2NO2 — CID 136810611
2-[4,5-bis(4-chlorophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol (PubChem CID 136810611) has the molecular formula C30H19Cl2NO2 and a molecular weight of 496.39 g/mol. Its IUPAC name is 2-[4,5-bis(4-chlorophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol.
| Compound Name | 2-[4,5-bis(4-chlorophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol |
|---|---|
| PubChem CID | 136810611 |
| Molecular Formula | C30H19Cl2NO2 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-[4,5-bis(4-chlorophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(-c2ccc(Cl)cc2)c2c(n1)-c1ccccc1OC2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H19Cl2NO2/c31-20-13-9-18(10-14-20)24-17-25(22-5-1-3-7-26(22)34)33-29-23-6-2-4-8-27(23)35-30(28(24)29)19-11-15-21(32)16-12-19/h1-17,30,34H |
| InChIKey | FFKDNDUVWMYBJR-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |