C30H19N3O6 — CID 135867842
2-[4,5-bis(3-nitrophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol (PubChem CID 135867842) has the molecular formula C30H19N3O6 and a molecular weight of 517.50 g/mol. Its IUPAC name is 2-[4,5-bis(3-nitrophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol.
| Compound Name | 2-[4,5-bis(3-nitrophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol |
|---|---|
| PubChem CID | 135867842 |
| Molecular Formula | C30H19N3O6 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 2-[4,5-bis(3-nitrophenyl)-5H-chromeno[4,3-b]pyridin-2-yl]phenol |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3ccccc3O)nc3c2C(c2cccc([N+](=O)[O-])c2)Oc2ccccc2-3)c1 |
| InChI | InChI=1S/C30H19N3O6/c34-26-13-3-1-11-22(26)25-17-24(18-7-5-9-20(15-18)32(35)36)28-29(31-25)23-12-2-4-14-27(23)39-30(28)19-8-6-10-21(16-19)33(37)38/h1-17,30,34H |
| InChIKey | DBOMSWKBQNMLIT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|