C24H17ClN4O4 — CID 135675291
5-[(4-chlorophenyl)methyl]-3-(2-hydroxyphenyl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135675291) has the molecular formula C24H17ClN4O4 and a molecular weight of 460.88 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-3-(2-hydroxyphenyl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 5-[(4-chlorophenyl)methyl]-3-(2-hydroxyphenyl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135675291 |
| Molecular Formula | C24H17ClN4O4 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-3-(2-hydroxyphenyl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | O=C1c2[nH]nc(-c3ccccc3O)c2C(c2cccc([N+](=O)[O-])c2)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN4O4/c25-16-10-8-14(9-11-16)13-28-23(15-4-3-5-17(12-15)29(32)33)20-21(26-27-22(20)24(28)31)18-6-1-2-7-19(18)30/h1-12,23,30H,13H2,(H,26,27) |
| InChIKey | KDUOFBITBMYFQH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|