C25H19ClN4O4 — CID 43857333
3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43857333) has the molecular formula C25H19ClN4O4 and a molecular weight of 474.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43857333 |
| Molecular Formula | C25H19ClN4O4 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | COc1ccc(CN2C(=O)c3[nH]nc(-c4ccc(Cl)cc4)c3C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H19ClN4O4/c1-34-20-11-5-15(6-12-20)14-29-24(17-3-2-4-19(13-17)30(32)33)21-22(27-28-23(21)25(29)31)16-7-9-18(26)10-8-16/h2-13,24H,14H2,1H3,(H,27,28) |
| InChIKey | SKMOESGFQVJPRW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|