C25H20N4O4 — CID 135675221
3-(2-hydroxyphenyl)-5-[(4-methylphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135675221) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-5-[(4-methylphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(2-hydroxyphenyl)-5-[(4-methylphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135675221 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-(2-hydroxyphenyl)-5-[(4-methylphenyl)methyl]-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1ccc(CN2C(=O)c3[nH]nc(-c4ccccc4O)c3C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H20N4O4/c1-15-9-11-16(12-10-15)14-28-24(17-5-4-6-18(13-17)29(32)33)21-22(26-27-23(21)25(28)31)19-7-2-3-8-20(19)30/h2-13,24,30H,14H2,1H3,(H,26,27) |
| InChIKey | KQRZQBDQBZIPMP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|