C21H14Cl2N2 — CID 100817143
2,4-bis(4-chlorophenyl)-1H-1,5-benzodiazepine (PubChem CID 100817143) has the molecular formula C21H14Cl2N2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-1H-1,5-benzodiazepine.
| Compound Name | 2,4-bis(4-chlorophenyl)-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 100817143 |
| Molecular Formula | C21H14Cl2N2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-1H-1,5-benzodiazepine |
| SMILES | Clc1ccc(C2=CC(c3ccc(Cl)cc3)=Nc3ccccc3N2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2/c22-16-9-5-14(6-10-16)20-13-21(15-7-11-17(23)12-8-15)25-19-4-2-1-3-18(19)24-20/h1-13,24H |
| InChIKey | HKNJIYANGLLMTO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |