C16H14ClN3 — CID 17198359
3-(3-chlorophenyl)-2-methyl-1H-1,5-benzodiazepin-4-amine (PubChem CID 17198359) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-methyl-1H-1,5-benzodiazepin-4-amine.
| Compound Name | 3-(3-chlorophenyl)-2-methyl-1H-1,5-benzodiazepin-4-amine |
|---|---|
| PubChem CID | 17198359 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-(3-chlorophenyl)-2-methyl-1H-1,5-benzodiazepin-4-amine |
| SMILES | CC1=C(c2cccc(Cl)c2)C(N)=Nc2ccccc2N1 |
| InChI | InChI=1S/C16H14ClN3/c1-10-15(11-5-4-6-12(17)9-11)16(18)20-14-8-3-2-7-13(14)19-10/h2-9,19H,1H3,(H2,18,20) |
| InChIKey | RPIGTTNVTKREAV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |