acetic acid;2,10-dihydrophenazine

C14H14N2O2 — CID 162312358

IUPACacetic acid;2,10-dihydrophenazine
SMILESC1=CC2=Nc3ccccc3NC2=CC1.CC(=O)O
InChIInChI=1S/C12H10N2.C2H4O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2(3)4/h1-3,5-8,14H,4H2;1H3,(H,3,4)
InChIKeyXRMGBFGIDPFWTN-UHFFFAOYSA-N
MW242.28 g/mol
LogP3.12
Rot. Bonds

About acetic acid;2,10-dihydrophenazine

acetic acid;2,10-dihydrophenazine (PubChem CID 162312358) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is acetic acid;2,10-dihydrophenazine.

Molecular Properties

Compound Nameacetic acid;2,10-dihydrophenazine
PubChem CID162312358
Molecular FormulaC14H14N2O2
Molecular Weight242.28 g/mol
Exact Mass242.11
IUPAC Nameacetic acid;2,10-dihydrophenazine
SMILESC1=CC2=Nc3ccccc3NC2=CC1.CC(=O)O
InChIInChI=1S/C12H10N2.C2H4O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2(3)4/h1-3,5-8,14H,4H2;1H3,(H,3,4)
InChIKeyXRMGBFGIDPFWTN-UHFFFAOYSA-N
XLogP3.12
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.28
LogP ≤ 53.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;2,10-dihydrophenazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2,10-dihydrophenazine?
The IUPAC name of acetic acid;2,10-dihydrophenazine (CID 162312358) is acetic acid;2,10-dihydrophenazine.
What is the SMILES notation for acetic acid;2,10-dihydrophenazine?
The canonical SMILES for acetic acid;2,10-dihydrophenazine is C1=CC2=Nc3ccccc3NC2=CC1.CC(=O)O.
What is the InChIKey of acetic acid;2,10-dihydrophenazine?
The InChIKey is XRMGBFGIDPFWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2.C2H4O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2(3)4/h1-3,5-8,14H,4H2;1H3,(H,3,4).
What are the key properties of acetic acid;2,10-dihydrophenazine?
acetic acid;2,10-dihydrophenazine has a molecular weight of 242.28 g/mol, XLogP of 3.12, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2,10-dihydrophenazine is sourced from PubChem (CID 162312358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).