About 6H-quinolin-2-one;hydrobromide
6H-quinolin-2-one;hydrobromide (PubChem CID 131715686) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 6H-quinolin-2-one;hydrobromide.
Molecular Properties
| Compound Name | 6H-quinolin-2-one;hydrobromide |
| PubChem CID | 131715686 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 6H-quinolin-2-one;hydrobromide |
| SMILES | Br.O=C1C=CC2=CCC=CC2=N1 |
| InChI | InChI=1S/C9H7NO.BrH/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h2-6H,1H2;1H |
| InChIKey | XZPVOGYLMXFCCR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-quinolin-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-quinolin-2-one;hydrobromide?
The IUPAC name of 6H-quinolin-2-one;hydrobromide (CID 131715686) is 6H-quinolin-2-one;hydrobromide.
What is the SMILES notation for 6H-quinolin-2-one;hydrobromide?
The canonical SMILES for 6H-quinolin-2-one;hydrobromide is Br.O=C1C=CC2=CCC=CC2=N1.
What is the InChIKey of 6H-quinolin-2-one;hydrobromide?
The InChIKey is XZPVOGYLMXFCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.BrH/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h2-6H,1H2;1H.
What are the key properties of 6H-quinolin-2-one;hydrobromide?
6H-quinolin-2-one;hydrobromide has a molecular weight of 226.07 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-quinolin-2-one;hydrobromide is sourced from PubChem (CID 131715686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).