C6H6OS — CID 86251595
2-sulfanylcyclohexa-2,5-dien-1-one (PubChem CID 86251595) has the molecular formula C6H6OS and a molecular weight of 126.18 g/mol. Its IUPAC name is 2-sulfanylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-sulfanylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 86251595 |
| Molecular Formula | C6H6OS |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 2-sulfanylcyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CCC=C1S |
| InChI | InChI=1S/C6H6OS/c7-5-3-1-2-4-6(5)8/h1,3-4,8H,2H2 |
| InChIKey | JOGXZQGIPBCQKU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|