C6H5NO3S — CID 87433552
2-nitro-3-sulfanylcyclohexa-2,5-dien-1-one (PubChem CID 87433552) has the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. Its IUPAC name is 2-nitro-3-sulfanylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-nitro-3-sulfanylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 87433552 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | 2-nitro-3-sulfanylcyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CCC(S)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5NO3S/c8-4-2-1-3-5(11)6(4)7(9)10/h1-2,11H,3H2 |
| InChIKey | RYTHOHNMCWBYHD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|