C7H7N3O5 — CID 154258459
3-[(5-nitro-3H-furan-2-ylidene)amino]-1,3-oxazolidin-2-one (PubChem CID 154258459) has the molecular formula C7H7N3O5 and a molecular weight of 213.15 g/mol. Its IUPAC name is 3-[(5-nitro-3H-furan-2-ylidene)amino]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(5-nitro-3H-furan-2-ylidene)amino]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 154258459 |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 3-[(5-nitro-3H-furan-2-ylidene)amino]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1N=C1CC=C([N+](=O)[O-])O1 |
| InChI | InChI=1S/C7H7N3O5/c11-7-9(3-4-14-7)8-5-1-2-6(15-5)10(12)13/h2H,1,3-4H2 |
| InChIKey | XXXBVWMXUQJXTP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|