C13H13N3O5 — CID 158449423
3-[2-[(6-nitro-3H-isoindol-5-yl)oxy]ethyl]-1,3-oxazolidin-2-one (PubChem CID 158449423) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 3-[2-[(6-nitro-3H-isoindol-5-yl)oxy]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[(6-nitro-3H-isoindol-5-yl)oxy]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 158449423 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[2-[(6-nitro-3H-isoindol-5-yl)oxy]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCOc1cc2c(cc1[N+](=O)[O-])C=NC2 |
| InChI | InChI=1S/C13H13N3O5/c17-13-15(2-4-21-13)1-3-20-12-6-10-8-14-7-9(10)5-11(12)16(18)19/h5-7H,1-4,8H2 |
| InChIKey | LPRBTTVBVMHWGK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|