About 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol
6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol (PubChem CID 158084112) has the molecular formula C20H19ClN4O6
and a molecular weight of 446.85 g/mol. Its IUPAC name is 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol.
Molecular Properties
| Compound Name | 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol |
| PubChem CID | 158084112 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol |
| SMILES | O=[N+]([O-])c1cc2c(cc1O)CN=C2.O=[N+]([O-])c1cc2c(cc1OCCCCCl)CN=C2 |
| InChI | InChI=1S/C12H13ClN2O3.C8H6N2O3/c13-3-1-2-4-18-12-6-10-8-14-7-9(10)5-11(12)15(16)17;11-8-2-6-4-9-3-5(6)1-7(8)10(12)13/h5-7H,1-4,8H2;1-3,11H,4H2 |
| InChIKey | FNHRDCSUFFPVCW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol?
The IUPAC name of 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol (CID 158084112) is 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol.
What is the SMILES notation for 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol?
The canonical SMILES for 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol is O=[N+]([O-])c1cc2c(cc1O)CN=C2.O=[N+]([O-])c1cc2c(cc1OCCCCCl)CN=C2.
What is the InChIKey of 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol?
The InChIKey is FNHRDCSUFFPVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O3.C8H6N2O3/c13-3-1-2-4-18-12-6-10-8-14-7-9(10)5-11(12)15(16)17;11-8-2-6-4-9-3-5(6)1-7(8)10(12)13/h5-7H,1-4,8H2;1-3,11H,4H2.
What are the key properties of 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol?
6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol has a molecular weight of 446.85 g/mol, XLogP of 4.16, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobutoxy)-5-nitro-1H-isoindole;6-nitro-3H-isoindol-5-ol is sourced from PubChem (CID 158084112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).