C12H6N4O11 — CID 102273145
5-(5-hydroxy-2,4-dinitrophenoxy)-2,4-dinitrophenol (PubChem CID 102273145) has the molecular formula C12H6N4O11 and a molecular weight of 382.20 g/mol. Its IUPAC name is 5-(5-hydroxy-2,4-dinitrophenoxy)-2,4-dinitrophenol.
| Compound Name | 5-(5-hydroxy-2,4-dinitrophenoxy)-2,4-dinitrophenol |
|---|---|
| PubChem CID | 102273145 |
| Molecular Formula | C12H6N4O11 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-(5-hydroxy-2,4-dinitrophenoxy)-2,4-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Oc2cc(O)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1O |
| InChI | InChI=1S/C12H6N4O11/c17-9-3-11(7(15(23)24)1-5(9)13(19)20)27-12-4-10(18)6(14(21)22)2-8(12)16(25)26/h1-4,17-18H |
| InChIKey | CSAHJMYYYOFKDR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 222.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|